C17H21BrN2O2 — CID 170884819
ethyl 2-amino-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]propanoate (PubChem CID 170884819) has the molecular formula C17H21BrN2O2 and a molecular weight of 365.27 g/mol. Its IUPAC name is ethyl 2-amino-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]propanoate.
| Compound Name | ethyl 2-amino-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]propanoate |
|---|---|
| PubChem CID | 170884819 |
| Molecular Formula | C17H21BrN2O2 |
| Molecular Weight | 365.27 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | ethyl 2-amino-3-[1-(4-bromophenyl)-2,5-dimethylpyrrol-3-yl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1cc(C)n(-c2ccc(Br)cc2)c1C |
| InChI | InChI=1S/C17H21BrN2O2/c1-4-22-17(21)16(19)10-13-9-11(2)20(12(13)3)15-7-5-14(18)6-8-15/h5-9,16H,4,10,19H2,1-3H3 |
| InChIKey | OBXZMSWYSHVHQC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|