C13H8F3N3O5 — CID 170887046
3-[1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-3-oxopropanoic acid (PubChem CID 170887046) has the molecular formula C13H8F3N3O5 and a molecular weight of 343.22 g/mol. Its IUPAC name is 3-[1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-3-oxopropanoic acid.
| Compound Name | 3-[1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 170887046 |
| Molecular Formula | C13H8F3N3O5 |
| Molecular Weight | 343.22 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 3-[1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazol-4-yl]-3-oxopropanoic acid |
| SMILES | O=C(O)CC(=O)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1C(F)(F)F |
| InChI | InChI=1S/C13H8F3N3O5/c14-13(15,16)12-9(10(20)5-11(21)22)6-17-18(12)7-1-3-8(4-2-7)19(23)24/h1-4,6H,5H2,(H,21,22) |
| InChIKey | OTJWBUDCMAXCBA-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|