C23H26F3N5O5 — CID 6733302
N'-[2-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetyl]-1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide (PubChem CID 6733302) has the molecular formula C23H26F3N5O5 and a molecular weight of 509.49 g/mol. Its IUPAC name is N'-[2-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetyl]-1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide.
| Compound Name | N'-[2-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetyl]-1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 6733302 |
| Molecular Formula | C23H26F3N5O5 |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | N'-[2-(3-hydroxy-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)acetyl]-1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carbohydrazide |
| SMILES | CC1(C)C2CCC1(C)C(O)C2CC(=O)NNC(=O)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1C(F)(F)F |
| InChI | InChI=1S/C23H26F3N5O5/c1-21(2)16-8-9-22(21,3)19(33)14(16)10-17(32)28-29-20(34)15-11-27-30(18(15)23(24,25)26)12-4-6-13(7-5-12)31(35)36/h4-7,11,14,16,19,33H,8-10H2,1-3H3,(H,28,32)(H,29,34) |
| InChIKey | HFPSQYQUWQWSJX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|