C19H14ClF3N4O3 — CID 90814630
N-[2-(3-chlorophenyl)ethyl]-1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 90814630) has the molecular formula C19H14ClF3N4O3 and a molecular weight of 438.79 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 90814630 |
| Molecular Formula | C19H14ClF3N4O3 |
| Molecular Weight | 438.79 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCc1cccc(Cl)c1)c1cnn(-c2ccc([N+](=O)[O-])cc2)c1C(F)(F)F |
| InChI | InChI=1S/C19H14ClF3N4O3/c20-13-3-1-2-12(10-13)8-9-24-18(28)16-11-25-26(17(16)19(21,22)23)14-4-6-15(7-5-14)27(29)30/h1-7,10-11H,8-9H2,(H,24,28) |
| InChIKey | NHPWTMFVGUCLAD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.79 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|