C15H8F3N7O3 — CID 2809050
5-amino-1-[1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]pyrazole-4-carbonitrile (PubChem CID 2809050) has the molecular formula C15H8F3N7O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is 5-amino-1-[1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 2809050 |
| Molecular Formula | C15H8F3N7O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 5-amino-1-[1-(4-nitrophenyl)-5-(trifluoromethyl)pyrazole-4-carbonyl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(C(=O)c2cnn(-c3ccc([N+](=O)[O-])cc3)c2C(F)(F)F)c1N |
| InChI | InChI=1S/C15H8F3N7O3/c16-15(17,18)12-11(14(26)24-13(20)8(5-19)6-21-24)7-22-23(12)9-1-3-10(4-2-9)25(27)28/h1-4,6-7H,20H2 |
| InChIKey | NYSMPWGBMVJQJN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|