C18H20ClNO2 — CID 170887821
(Z)-4-chloro-3,4-bis(4-methoxyphenyl)but-3-en-1-amine (PubChem CID 170887821) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is (Z)-4-chloro-3,4-bis(4-methoxyphenyl)but-3-en-1-amine.
| Compound Name | (Z)-4-chloro-3,4-bis(4-methoxyphenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 170887821 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (Z)-4-chloro-3,4-bis(4-methoxyphenyl)but-3-en-1-amine |
| SMILES | COc1ccc(/C(Cl)=C(\CCN)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H20ClNO2/c1-21-15-7-3-13(4-8-15)17(11-12-20)18(19)14-5-9-16(22-2)10-6-14/h3-10H,11-12,20H2,1-2H3/b18-17- |
| InChIKey | ZOSDHWZIQDGNQT-ZCXUNETKSA-N |
| XLogP | 4.16 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|