C17H17ClO3 — CID 58223742
(E)-3-chloro-2,3-bis(4-methoxyphenyl)prop-2-en-1-ol (PubChem CID 58223742) has the molecular formula C17H17ClO3 and a molecular weight of 304.77 g/mol. Its IUPAC name is (E)-3-chloro-2,3-bis(4-methoxyphenyl)prop-2-en-1-ol.
| Compound Name | (E)-3-chloro-2,3-bis(4-methoxyphenyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 58223742 |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (E)-3-chloro-2,3-bis(4-methoxyphenyl)prop-2-en-1-ol |
| SMILES | COc1ccc(/C(Cl)=C(\CO)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H17ClO3/c1-20-14-7-3-12(4-8-14)16(11-19)17(18)13-5-9-15(21-2)10-6-13/h3-10,19H,11H2,1-2H3/b17-16- |
| InChIKey | XRQHEUFJJJFRQG-MSUUIHNZSA-N |
| XLogP | 3.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|