C18H16Cl2O2 — CID 44604980
1-[(1Z,3Z)-1,4-dichloro-4-(4-methoxyphenyl)buta-1,3-dienyl]-4-methoxybenzene (PubChem CID 44604980) has the molecular formula C18H16Cl2O2 and a molecular weight of 335.23 g/mol. Its IUPAC name is 1-[(1Z,3Z)-1,4-dichloro-4-(4-methoxyphenyl)buta-1,3-dienyl]-4-methoxybenzene.
| Compound Name | 1-[(1Z,3Z)-1,4-dichloro-4-(4-methoxyphenyl)buta-1,3-dienyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 44604980 |
| Molecular Formula | C18H16Cl2O2 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 1-[(1Z,3Z)-1,4-dichloro-4-(4-methoxyphenyl)buta-1,3-dienyl]-4-methoxybenzene |
| SMILES | COc1ccc(/C(Cl)=C/C=C(\Cl)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H16Cl2O2/c1-21-15-7-3-13(4-8-15)17(19)11-12-18(20)14-5-9-16(22-2)10-6-14/h3-12H,1-2H3/b17-11-,18-12- |
| InChIKey | DVHRVNARVMPCBC-WHYMJUELSA-N |
| XLogP | 5.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|