C17H17Cl2NO5 — CID 43833571
[(Z)-3-chloro-3-(4-methylphenyl)prop-2-enylidene]-(4-methoxyphenyl)azanium perchlorate (PubChem CID 43833571) has the molecular formula C17H17Cl2NO5 and a molecular weight of 386.23 g/mol. Its IUPAC name is [(Z)-3-chloro-3-(4-methylphenyl)prop-2-enylidene]-(4-methoxyphenyl)azanium perchlorate.
| Compound Name | [(Z)-3-chloro-3-(4-methylphenyl)prop-2-enylidene]-(4-methoxyphenyl)azanium perchlorate |
|---|---|
| PubChem CID | 43833571 |
| Molecular Formula | C17H17Cl2NO5 |
| Molecular Weight | 386.23 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | [(Z)-3-chloro-3-(4-methylphenyl)prop-2-enylidene]-(4-methoxyphenyl)azanium perchlorate |
| SMILES | COc1ccc(/[NH+]=C/C=C(\Cl)c2ccc(C)cc2)cc1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C17H16ClNO.ClHO4/c1-13-3-5-14(6-4-13)17(18)11-12-19-15-7-9-16(20-2)10-8-15;2-1(3,4)5/h3-12H,1-2H3;(H,2,3,4,5)/b17-11-,19-12+; |
| InChIKey | VDBXEKRMRHBENN-BGKBWVJQSA-N |
| XLogP | -1.69 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.23 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|