About bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium
bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium (PubChem CID 170896531) has the molecular formula C26H26N2O7V
and a molecular weight of 529.45 g/mol. Its IUPAC name is bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium.
Molecular Properties
| Compound Name | bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium |
| PubChem CID | 170896531 |
| Molecular Formula | C26H26N2O7V |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium |
| SMILES | COc1cccc(/C=N/Cc2ccco2)c1O.COc1cccc(/C=N\Cc2ccco2)c1O.O=[V] |
| InChI | InChI=1S/2C13H13NO3.O.V/c2*1-16-12-6-2-4-10(13(12)15)8-14-9-11-5-3-7-17-11;;/h2*2-8,15H,9H2,1H3;;/b14-8+;14-8-;; |
| InChIKey | HJLVUDWPXJRCJA-LHLQOPPDSA-N |
| XLogP | 5.10 |
| TPSA | 126.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium?
The IUPAC name of bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium (CID 170896531) is bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium.
What is the SMILES notation for bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium?
The canonical SMILES for bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium is COc1cccc(/C=N/Cc2ccco2)c1O.COc1cccc(/C=N\Cc2ccco2)c1O.O=[V].
What is the InChIKey of bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium?
The InChIKey is HJLVUDWPXJRCJA-LHLQOPPDSA-N. The full InChI is InChI=1S/2C13H13NO3.O.V/c2*1-16-12-6-2-4-10(13(12)15)8-14-9-11-5-3-7-17-11;;/h2*2-8,15H,9H2,1H3;;/b14-8+;14-8-;;.
What are the key properties of bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium?
bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium has a molecular weight of 529.45 g/mol, XLogP of 5.10, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(furan-2-ylmethyliminomethyl)-6-methoxyphenol);oxovanadium is sourced from PubChem (CID 170896531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).