C12H19N2O11P — CID 170896728
azanium (1R,2S,3S,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-[hydroxy-(4-nitrophenoxy)phosphoryl]oxycyclohexan-1-olate (PubChem CID 170896728) has the molecular formula C12H19N2O11P and a molecular weight of 398.26 g/mol. Its IUPAC name is azanium (1R,2S,3S,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-[hydroxy-(4-nitrophenoxy)phosphoryl]oxycyclohexan-1-olate.
| Compound Name | azanium (1R,2S,3S,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-[hydroxy-(4-nitrophenoxy)phosphoryl]oxycyclohexan-1-olate |
|---|---|
| PubChem CID | 170896728 |
| Molecular Formula | C12H19N2O11P |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | azanium (1R,2S,3S,4R,5R,6S)-2,3,4,5-tetrahydroxy-6-[hydroxy-(4-nitrophenoxy)phosphoryl]oxycyclohexan-1-olate |
| SMILES | O=[N+]([O-])c1ccc(OP(=O)(O)O[C@H]2[C@H]([O-])[C@H](O)[C@H](O)[C@@H](O)[C@H]2O)cc1.[NH4+] |
| InChI | InChI=1S/C12H15NO11P.H3N/c14-7-8(15)10(17)12(11(18)9(7)16)24-25(21,22)23-6-3-1-5(2-4-6)13(19)20;/h1-4,7-12,14-17H,(H,21,22);1H3/q-1;/p+1/t7-,8-,9-,10-,11-,12-;/m1./s1 |
| InChIKey | JDHOSGCTUVQPRG-YINNELIFSA-O |
| XLogP | -1.98 |
| TPSA | 239.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|