C20H36N2 — CID 170900098
2-N,3-N-bis[(1R)-1-cyclohexylethyl]butane-2,3-diimine (PubChem CID 170900098) has the molecular formula C20H36N2 and a molecular weight of 304.52 g/mol. Its IUPAC name is 2-N,3-N-bis[(1R)-1-cyclohexylethyl]butane-2,3-diimine.
| Compound Name | 2-N,3-N-bis[(1R)-1-cyclohexylethyl]butane-2,3-diimine |
|---|---|
| PubChem CID | 170900098 |
| Molecular Formula | C20H36N2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 2-N,3-N-bis[(1R)-1-cyclohexylethyl]butane-2,3-diimine |
| SMILES | CC(=N\[C@H](C)C1CCCCC1)/C(C)=N/[C@H](C)C1CCCCC1 |
| InChI | InChI=1S/C20H36N2/c1-15(21-17(3)19-11-7-5-8-12-19)16(2)22-18(4)20-13-9-6-10-14-20/h17-20H,5-14H2,1-4H3/b21-15+,22-16+/t17-,18-/m1/s1 |
| InChIKey | XOWBPEROMYNHJS-KRIWGBNCSA-N |
| XLogP | 5.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|