C6H4ClIN4 — CID 170900285
7-chloro-6-iodo-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 170900285) has the molecular formula C6H4ClIN4 and a molecular weight of 294.48 g/mol. Its IUPAC name is 7-chloro-6-iodo-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-chloro-6-iodo-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 170900285 |
| Molecular Formula | C6H4ClIN4 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 293.92 |
| IUPAC Name | 7-chloro-6-iodo-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1nc2ncnn2c(Cl)c1I |
| InChI | InChI=1S/C6H4ClIN4/c1-3-4(8)5(7)12-6(11-3)9-2-10-12/h2H,1H3 |
| InChIKey | PRORUGYQGJKDRF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|