C46H52N6O8 — CID 170909065
N'-(9-ethylcarbazol-3-yl)-N-[[3-[[3-[(9-ethylcarbazol-3-yl)amino]propylamino]methyl]phenyl]methyl]propane-1,3-diamine;oxalic acid (PubChem CID 170909065) has the molecular formula C46H52N6O8 and a molecular weight of 816.96 g/mol. Its IUPAC name is N'-(9-ethylcarbazol-3-yl)-N-[[3-[[3-[(9-ethylcarbazol-3-yl)amino]propylamino]methyl]phenyl]methyl]propane-1,3-diamine;oxalic acid.
| Compound Name | N'-(9-ethylcarbazol-3-yl)-N-[[3-[[3-[(9-ethylcarbazol-3-yl)amino]propylamino]methyl]phenyl]methyl]propane-1,3-diamine;oxalic acid |
|---|---|
| PubChem CID | 170909065 |
| Molecular Formula | C46H52N6O8 |
| Molecular Weight | 816.96 g/mol |
| Exact Mass | 816.38 |
| IUPAC Name | N'-(9-ethylcarbazol-3-yl)-N-[[3-[[3-[(9-ethylcarbazol-3-yl)amino]propylamino]methyl]phenyl]methyl]propane-1,3-diamine;oxalic acid |
| SMILES | CCn1c2ccccc2c2cc(NCCCNCc3cccc(CNCCCNc4ccc5c(c4)c4ccccc4n5CC)c3)ccc21.O=C(O)C(=O)O.O=C(O)C(=O)O |
| InChI | InChI=1S/C42H48N6.2C2H2O4/c1-3-47-39-16-7-5-14-35(39)37-27-33(18-20-41(37)47)45-24-10-22-43-29-31-12-9-13-32(26-31)30-44-23-11-25-46-34-19-21-42-38(28-34)36-15-6-8-17-40(36)48(42)4-2;2*3-1(4)2(5)6/h5-9,12-21,26-28,43-46H,3-4,10-11,22-25,29-30H2,1-2H3;2*(H,3,4)(H,5,6) |
| InChIKey | CSDHHHAPACEQHQ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 207.18 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.96 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|