C27H28N4O — CID 175455610
N-[3-[(9-ethylcarbazol-3-yl)methylamino]propyl]-1H-indole-2-carboxamide (PubChem CID 175455610) has the molecular formula C27H28N4O and a molecular weight of 424.55 g/mol. Its IUPAC name is N-[3-[(9-ethylcarbazol-3-yl)methylamino]propyl]-1H-indole-2-carboxamide.
| Compound Name | N-[3-[(9-ethylcarbazol-3-yl)methylamino]propyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 175455610 |
| Molecular Formula | C27H28N4O |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-[3-[(9-ethylcarbazol-3-yl)methylamino]propyl]-1H-indole-2-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(CNCCCNC(=O)c3cc4ccccc4[nH]3)ccc21 |
| InChI | InChI=1S/C27H28N4O/c1-2-31-25-11-6-4-9-21(25)22-16-19(12-13-26(22)31)18-28-14-7-15-29-27(32)24-17-20-8-3-5-10-23(20)30-24/h3-6,8-13,16-17,28,30H,2,7,14-15,18H2,1H3,(H,29,32) |
| InChIKey | VEMXEVBZSOAWLT-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|