C9H18ClN3OS — CID 170909343
5-tert-butyl-3-ethyl-2-imino-1,3,5-thiadiazinan-4-one;hydrochloride (PubChem CID 170909343) has the molecular formula C9H18ClN3OS and a molecular weight of 251.78 g/mol. Its IUPAC name is 5-tert-butyl-3-ethyl-2-imino-1,3,5-thiadiazinan-4-one;hydrochloride.
| Compound Name | 5-tert-butyl-3-ethyl-2-imino-1,3,5-thiadiazinan-4-one;hydrochloride |
|---|---|
| PubChem CID | 170909343 |
| Molecular Formula | C9H18ClN3OS |
| Molecular Weight | 251.78 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-tert-butyl-3-ethyl-2-imino-1,3,5-thiadiazinan-4-one;hydrochloride |
| SMILES | Cl.[H]/N=C1\SCN(C(C)(C)C)C(=O)N1CC |
| InChI | InChI=1S/C9H17N3OS.ClH/c1-5-11-7(10)14-6-12(8(11)13)9(2,3)4;/h10H,5-6H2,1-4H3;1H/b10-7-; |
| InChIKey | AKYBDDIXQZBWRY-VEZAGKLZSA-N |
| XLogP | 2.59 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.78 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|