C9H17N3OS — CID 170909364
5-butyl-3-ethyl-2-imino-1,3,5-thiadiazinan-4-one (PubChem CID 170909364) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 5-butyl-3-ethyl-2-imino-1,3,5-thiadiazinan-4-one.
| Compound Name | 5-butyl-3-ethyl-2-imino-1,3,5-thiadiazinan-4-one |
|---|---|
| PubChem CID | 170909364 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 5-butyl-3-ethyl-2-imino-1,3,5-thiadiazinan-4-one |
| SMILES | [H]/N=C1\SCN(CCCC)C(=O)N1CC |
| InChI | InChI=1S/C9H17N3OS/c1-3-5-6-11-7-14-8(10)12(4-2)9(11)13/h10H,3-7H2,1-2H3/b10-8- |
| InChIKey | XMRWPOQLWKOCDN-NTMALXAHSA-N |
| XLogP | 2.17 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|