C10H20INOS — CID 175437358
2-(3-butyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide (PubChem CID 175437358) has the molecular formula C10H20INOS and a molecular weight of 329.25 g/mol. Its IUPAC name is 2-(3-butyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide.
| Compound Name | 2-(3-butyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide |
|---|---|
| PubChem CID | 175437358 |
| Molecular Formula | C10H20INOS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 2-(3-butyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydroiodide |
| SMILES | CCCCN1CSC(CCO)=C1C.I |
| InChI | InChI=1S/C10H19NOS.HI/c1-3-4-6-11-8-13-10(5-7-12)9(11)2;/h12H,3-8H2,1-2H3;1H |
| InChIKey | QZFMZUKBUUBNOA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|