C10H21NO2S — CID 174635774
2-(3-butyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydrate (PubChem CID 174635774) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is 2-(3-butyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydrate.
| Compound Name | 2-(3-butyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydrate |
|---|---|
| PubChem CID | 174635774 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 2-(3-butyl-4-methyl-2H-1,3-thiazol-5-yl)ethanol;hydrate |
| SMILES | CCCCN1CSC(CCO)=C1C.O |
| InChI | InChI=1S/C10H19NOS.H2O/c1-3-4-6-11-8-13-10(5-7-12)9(11)2;/h12H,3-8H2,1-2H3;1H2 |
| InChIKey | SLSUYCVFQBWAQZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 54.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |