C5H8F3NO2S — CID 170914011
(3R,5S)-1,1-dioxo-5-(trifluoromethyl)thiolan-3-amine (PubChem CID 170914011) has the molecular formula C5H8F3NO2S and a molecular weight of 203.18 g/mol. Its IUPAC name is (3R,5S)-1,1-dioxo-5-(trifluoromethyl)thiolan-3-amine.
| Compound Name | (3R,5S)-1,1-dioxo-5-(trifluoromethyl)thiolan-3-amine |
|---|---|
| PubChem CID | 170914011 |
| Molecular Formula | C5H8F3NO2S |
| Molecular Weight | 203.18 g/mol |
| Exact Mass | 203.02 |
| IUPAC Name | (3R,5S)-1,1-dioxo-5-(trifluoromethyl)thiolan-3-amine |
| SMILES | N[C@@H]1C[C@@H](C(F)(F)F)S(=O)(=O)C1 |
| InChI | InChI=1S/C5H8F3NO2S/c6-5(7,8)4-1-3(9)2-12(4,10)11/h3-4H,1-2,9H2/t3-,4+/m1/s1 |
| InChIKey | VPKKKBLOILVINU-DMTCNVIQSA-N |
| XLogP | 0.06 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.18 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |