2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide

C5H5F5O2S — CID 67425968

IUPAC2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide
SMILESO=S1(=O)C(F)CC(C(F)(F)F)C1F
InChIInChI=1S/C5H5F5O2S/c6-3-1-2(5(8,9)10)4(7)13(3,11)12/h2-4H,1H2
InChIKeyFAVUQUJQKTULCZ-UHFFFAOYSA-N
MW224.15 g/mol
LogP1.57
Rot. Bonds

About 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide

2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide (PubChem CID 67425968) has the molecular formula C5H5F5O2S and a molecular weight of 224.15 g/mol. Its IUPAC name is 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide.

Molecular Properties

Compound Name2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide
PubChem CID67425968
Molecular FormulaC5H5F5O2S
Molecular Weight224.15 g/mol
Exact Mass223.99
IUPAC Name2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide
SMILESO=S1(=O)C(F)CC(C(F)(F)F)C1F
InChIInChI=1S/C5H5F5O2S/c6-3-1-2(5(8,9)10)4(7)13(3,11)12/h2-4H,1H2
InChIKeyFAVUQUJQKTULCZ-UHFFFAOYSA-N
XLogP1.57
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.15
LogP ≤ 51.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide?
The IUPAC name of 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide (CID 67425968) is 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide.
What is the SMILES notation for 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide?
The canonical SMILES for 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide is O=S1(=O)C(F)CC(C(F)(F)F)C1F.
What is the InChIKey of 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide?
The InChIKey is FAVUQUJQKTULCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F5O2S/c6-3-1-2(5(8,9)10)4(7)13(3,11)12/h2-4H,1H2.
What are the key properties of 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide?
2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide has a molecular weight of 224.15 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-difluoro-3-(trifluoromethyl)thiolane 1,1-dioxide is sourced from PubChem (CID 67425968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).