C11H17Cl2N3O2 — CID 170918592
[4-(2-methoxyethoxy)-1H-benzimidazol-2-yl]methanamine;dihydrochloride (PubChem CID 170918592) has the molecular formula C11H17Cl2N3O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is [4-(2-methoxyethoxy)-1H-benzimidazol-2-yl]methanamine;dihydrochloride.
| Compound Name | [4-(2-methoxyethoxy)-1H-benzimidazol-2-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 170918592 |
| Molecular Formula | C11H17Cl2N3O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | [4-(2-methoxyethoxy)-1H-benzimidazol-2-yl]methanamine;dihydrochloride |
| SMILES | COCCOc1cccc2[nH]c(CN)nc12.Cl.Cl |
| InChI | InChI=1S/C11H15N3O2.2ClH/c1-15-5-6-16-9-4-2-3-8-11(9)14-10(7-12)13-8;;/h2-4H,5-7,12H2,1H3,(H,13,14);2*1H |
| InChIKey | DVWDDPDGMSJNNI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|