C32H38N4O6 — CID 170921635
bis[3-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylamino]propyl] oxalate (PubChem CID 170921635) has the molecular formula C32H38N4O6 and a molecular weight of 574.68 g/mol. Its IUPAC name is bis[3-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylamino]propyl] oxalate.
| Compound Name | bis[3-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylamino]propyl] oxalate |
|---|---|
| PubChem CID | 170921635 |
| Molecular Formula | C32H38N4O6 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.28 |
| IUPAC Name | bis[3-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methylamino]propyl] oxalate |
| SMILES | Cc1cc(C)c2cc(CNCCCOC(=O)C(=O)OCCCNCc3cc4c(C)cc(C)cc4[nH]c3=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C32H38N4O6/c1-19-11-21(3)25-15-23(29(37)35-27(25)13-19)17-33-7-5-9-41-31(39)32(40)42-10-6-8-34-18-24-16-26-22(4)12-20(2)14-28(26)36-30(24)38/h11-16,33-34H,5-10,17-18H2,1-4H3,(H,35,37)(H,36,38) |
| InChIKey | IXHSNNQLBIQDLU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 142.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|