C19H16N4O7 — CID 170922108
7-[2-[(2,4-dinitrophenyl)diazenyl]propoxy]-4-methylchromen-2-one (PubChem CID 170922108) has the molecular formula C19H16N4O7 and a molecular weight of 412.36 g/mol. Its IUPAC name is 7-[2-[(2,4-dinitrophenyl)diazenyl]propoxy]-4-methylchromen-2-one.
| Compound Name | 7-[2-[(2,4-dinitrophenyl)diazenyl]propoxy]-4-methylchromen-2-one |
|---|---|
| PubChem CID | 170922108 |
| Molecular Formula | C19H16N4O7 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 7-[2-[(2,4-dinitrophenyl)diazenyl]propoxy]-4-methylchromen-2-one |
| SMILES | Cc1cc(=O)oc2cc(OCC(C)/N=N/c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C19H16N4O7/c1-11-7-19(24)30-18-9-14(4-5-15(11)18)29-10-12(2)20-21-16-6-3-13(22(25)26)8-17(16)23(27)28/h3-9,12H,10H2,1-2H3/b21-20+ |
| InChIKey | SFIXFXWDYSLCGP-QZQOTICOSA-N |
| XLogP | 4.47 |
| TPSA | 150.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|