C51H29N3OS — CID 170926607
2-(2,8-dideuterio-6-phenanthren-9-yldibenzofuran-1-yl)-4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)-6-naphthalen-2-yl-1,3,5-triazine (PubChem CID 170926607) has the molecular formula C51H29N3OS and a molecular weight of 740.93 g/mol. Its IUPAC name is 2-(2,8-dideuterio-6-phenanthren-9-yldibenzofuran-1-yl)-4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)-6-naphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-(2,8-dideuterio-6-phenanthren-9-yldibenzofuran-1-yl)-4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)-6-naphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 170926607 |
| Molecular Formula | C51H29N3OS |
| Molecular Weight | 740.93 g/mol |
| Exact Mass | 740.26 |
| IUPAC Name | 2-(2,8-dideuterio-6-phenanthren-9-yldibenzofuran-1-yl)-4-(1,2,4,6,7,8,9-heptadeuteriodibenzothiophen-3-yl)-6-naphthalen-2-yl-1,3,5-triazine |
| SMILES | [2H]c1cc(-c2cc3ccccc3c3ccccc23)c2oc3ccc([2H])c(-c4nc(-c5ccc6ccccc6c5)nc(-c5c([2H])c([2H])c6c(sc7c([2H])c([2H])c([2H])c([2H])c76)c5[2H])n4)c3c2c1 |
| InChI | InChI=1S/C51H29N3OS/c1-2-12-31-27-33(24-23-30(31)11-1)49-52-50(34-25-26-39-38-17-7-8-22-45(38)56-46(39)29-34)54-51(53-49)42-20-10-21-44-47(42)41-19-9-18-40(48(41)55-44)43-28-32-13-3-4-14-35(32)36-15-5-6-16-37(36)43/h1-29H/i7D,8D,9D,17D,20D,22D,25D,26D,29D |
| InChIKey | DMQXQCSEQORFCO-XHLFRLAJSA-N |
| XLogP | 14.27 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.93 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|