C47H27N3OS — CID 170926573
2,4-dinaphthalen-2-yl-6-[2,4,6,8-tetradeuterio-3-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)dibenzofuran-1-yl]-1,3,5-triazine (PubChem CID 170926573) has the molecular formula C47H27N3OS and a molecular weight of 692.89 g/mol. Its IUPAC name is 2,4-dinaphthalen-2-yl-6-[2,4,6,8-tetradeuterio-3-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)dibenzofuran-1-yl]-1,3,5-triazine.
| Compound Name | 2,4-dinaphthalen-2-yl-6-[2,4,6,8-tetradeuterio-3-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)dibenzofuran-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 170926573 |
| Molecular Formula | C47H27N3OS |
| Molecular Weight | 692.89 g/mol |
| Exact Mass | 692.26 |
| IUPAC Name | 2,4-dinaphthalen-2-yl-6-[2,4,6,8-tetradeuterio-3-(1,2,3,6,7,8,9-heptadeuteriodibenzothiophen-4-yl)dibenzofuran-1-yl]-1,3,5-triazine |
| SMILES | [2H]c1cc([2H])c2oc3c([2H])c(-c4c([2H])c([2H])c([2H])c5c4sc4c([2H])c([2H])c([2H])c([2H])c45)c([2H])c(-c4nc(-c5ccc6ccccc6c5)nc(-c5ccc6ccccc6c5)n4)c3c2c1 |
| InChI | InChI=1S/C47H27N3OS/c1-3-12-30-24-32(22-20-28(30)10-1)45-48-46(33-23-21-29-11-2-4-13-31(29)25-33)50-47(49-45)39-26-34(27-41-43(39)38-15-5-7-18-40(38)51-41)35-16-9-17-37-36-14-6-8-19-42(36)52-44(35)37/h1-27H/i5D,6D,8D,9D,14D,16D,17D,18D,19D,26D,27D |
| InChIKey | FOVMQUUCCCFDEP-HSPRHLQFSA-N |
| XLogP | 13.11 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.89 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |