C20H13Cl2N3O3 — CID 170928931
4-benzyl-1-(2,6-dichloro-4-nitrophenyl)pyrrolo[3,2-b]pyridin-5-one (PubChem CID 170928931) has the molecular formula C20H13Cl2N3O3 and a molecular weight of 414.25 g/mol. Its IUPAC name is 4-benzyl-1-(2,6-dichloro-4-nitrophenyl)pyrrolo[3,2-b]pyridin-5-one.
| Compound Name | 4-benzyl-1-(2,6-dichloro-4-nitrophenyl)pyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 170928931 |
| Molecular Formula | C20H13Cl2N3O3 |
| Molecular Weight | 414.25 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | 4-benzyl-1-(2,6-dichloro-4-nitrophenyl)pyrrolo[3,2-b]pyridin-5-one |
| SMILES | O=c1ccc2c(ccn2-c2c(Cl)cc([N+](=O)[O-])cc2Cl)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H13Cl2N3O3/c21-15-10-14(25(27)28)11-16(22)20(15)23-9-8-18-17(23)6-7-19(26)24(18)12-13-4-2-1-3-5-13/h1-11H,12H2 |
| InChIKey | FNJGGWCPWOMUOK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 70.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.25 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|