C31H26FIrN2S- — CID 170931356
1-[2,6-di(propan-2-yl)phenyl]-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)benzimidazole;iridium (PubChem CID 170931356) has the molecular formula C31H26FIrN2S- and a molecular weight of 669.85 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)benzimidazole;iridium.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)benzimidazole;iridium |
|---|---|
| PubChem CID | 170931356 |
| Molecular Formula | C31H26FIrN2S- |
| Molecular Weight | 669.85 g/mol |
| Exact Mass | 670.14 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-2-(7-fluoro-3H-dibenzothiophen-3-id-4-yl)benzimidazole;iridium |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1c(-c2[c-]ccc3c2sc2cc(F)ccc23)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C31H26FN2S.Ir/c1-18(2)21-9-7-10-22(19(3)4)29(21)34-27-14-6-5-13-26(27)33-31(34)25-12-8-11-24-23-16-15-20(32)17-28(23)35-30(24)25;/h5-11,13-19H,1-4H3;/q-1; |
| InChIKey | LTJCAWZIGRVYIM-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.85 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|