C30H43N7O8S — CID 170931656
1-[2-[4-[3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]piperazin-1-yl]ethyl]-3-sulfanylpyrrolidine-2,5-dione (PubChem CID 170931656) has the molecular formula C30H43N7O8S and a molecular weight of 661.78 g/mol. Its IUPAC name is 1-[2-[4-[3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]piperazin-1-yl]ethyl]-3-sulfanylpyrrolidine-2,5-dione.
| Compound Name | 1-[2-[4-[3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]piperazin-1-yl]ethyl]-3-sulfanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 170931656 |
| Molecular Formula | C30H43N7O8S |
| Molecular Weight | 661.78 g/mol |
| Exact Mass | 661.29 |
| IUPAC Name | 1-[2-[4-[3-[2-[2-[2-[2-[4-(6-methyl-1,2,4,5-tetrazin-3-yl)phenoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoyl]piperazin-1-yl]ethyl]-3-sulfanylpyrrolidine-2,5-dione |
| SMILES | Cc1nnc(-c2ccc(OCCOCCOCCOCCOCCC(=O)N3CCN(CCN4C(=O)CC(S)C4=O)CC3)cc2)nn1 |
| InChI | InChI=1S/C30H43N7O8S/c1-23-31-33-29(34-32-23)24-2-4-25(5-3-24)45-21-20-44-19-18-43-17-16-42-15-14-41-13-6-27(38)36-10-7-35(8-11-36)9-12-37-28(39)22-26(46)30(37)40/h2-5,26,46H,6-22H2,1H3 |
| InChIKey | JYVAHHCDQXBBHW-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 158.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.78 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|