C39H33N3PtS — CID 170934319
(3aR,8bS)-3a,4,4,8b-tetramethyl-2-[3-methyl-5-[2-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]benzene-6-id-1-yl]indeno[2,1-d][1,3]thiazole;platinum(2+) (PubChem CID 170934319) has the molecular formula C39H33N3PtS and a molecular weight of 770.86 g/mol. Its IUPAC name is (3aR,8bS)-3a,4,4,8b-tetramethyl-2-[3-methyl-5-[2-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]benzene-6-id-1-yl]indeno[2,1-d][1,3]thiazole;platinum(2+).
| Compound Name | (3aR,8bS)-3a,4,4,8b-tetramethyl-2-[3-methyl-5-[2-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]benzene-6-id-1-yl]indeno[2,1-d][1,3]thiazole;platinum(2+) |
|---|---|
| PubChem CID | 170934319 |
| Molecular Formula | C39H33N3PtS |
| Molecular Weight | 770.86 g/mol |
| Exact Mass | 770.20 |
| IUPAC Name | (3aR,8bS)-3a,4,4,8b-tetramethyl-2-[3-methyl-5-[2-(4-methyl-2-pyridinyl)-1H-carbazol-1-id-9-yl]benzene-6-id-1-yl]indeno[2,1-d][1,3]thiazole;platinum(2+) |
| SMILES | Cc1cc(C2=N[C@]3(C)C(C)(C)c4ccccc4[C@]3(C)S2)[c-]c(-n2c3[c-]c(-c4cc(C)ccn4)ccc3c3ccccc32)c1.[Pt+2] |
| InChI | InChI=1S/C39H33N3S.Pt/c1-24-17-18-40-33(21-24)26-15-16-30-29-11-7-10-14-34(29)42(35(30)23-26)28-20-25(2)19-27(22-28)36-41-39(6)37(3,4)31-12-8-9-13-32(31)38(39,5)43-36;/h7-21H,1-6H3;/q-2;+2/t38-,39+;/m0./s1 |
| InChIKey | UTOZDFRQYGTHAA-MAVUKPMZSA-N |
| XLogP | 9.52 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.86 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|