C15H17F3N2O3 — CID 170947855
2-[2-(1,3-dioxolan-2-yl)-3-pyridinyl]-4-(trifluoromethyl)piperidine-1-carbaldehyde (PubChem CID 170947855) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-[2-(1,3-dioxolan-2-yl)-3-pyridinyl]-4-(trifluoromethyl)piperidine-1-carbaldehyde.
| Compound Name | 2-[2-(1,3-dioxolan-2-yl)-3-pyridinyl]-4-(trifluoromethyl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 170947855 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 2-[2-(1,3-dioxolan-2-yl)-3-pyridinyl]-4-(trifluoromethyl)piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(C(F)(F)F)CC1c1cccnc1C1OCCO1 |
| InChI | InChI=1S/C15H17F3N2O3/c16-15(17,18)10-3-5-20(9-21)12(8-10)11-2-1-4-19-13(11)14-22-6-7-23-14/h1-2,4,9-10,12,14H,3,5-8H2 |
| InChIKey | KXBXTGKYNCHCOM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|