C12H15F3N2 — CID 145285268
3-[(2S,4R)-1-methyl-4-(trifluoromethyl)piperidin-2-yl]pyridine (PubChem CID 145285268) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 3-[(2S,4R)-1-methyl-4-(trifluoromethyl)piperidin-2-yl]pyridine.
| Compound Name | 3-[(2S,4R)-1-methyl-4-(trifluoromethyl)piperidin-2-yl]pyridine |
|---|---|
| PubChem CID | 145285268 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-[(2S,4R)-1-methyl-4-(trifluoromethyl)piperidin-2-yl]pyridine |
| SMILES | CN1CC[C@@H](C(F)(F)F)C[C@H]1c1cccnc1 |
| InChI | InChI=1S/C12H15F3N2/c1-17-6-4-10(12(13,14)15)7-11(17)9-3-2-5-16-8-9/h2-3,5,8,10-11H,4,6-7H2,1H3/t10-,11+/m1/s1 |
| InChIKey | MDOWGKGRPUIMEA-MNOVXSKESA-N |
| XLogP | 3.03 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |