C14H12N4O2S2 — CID 170949666
N-(3-cyano-1H-indol-7-yl)-2-ethyl-1,3-thiazole-4-sulfonamide (PubChem CID 170949666) has the molecular formula C14H12N4O2S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is N-(3-cyano-1H-indol-7-yl)-2-ethyl-1,3-thiazole-4-sulfonamide.
| Compound Name | N-(3-cyano-1H-indol-7-yl)-2-ethyl-1,3-thiazole-4-sulfonamide |
|---|---|
| PubChem CID | 170949666 |
| Molecular Formula | C14H12N4O2S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | N-(3-cyano-1H-indol-7-yl)-2-ethyl-1,3-thiazole-4-sulfonamide |
| SMILES | CCc1nc(S(=O)(=O)Nc2cccc3c(C#N)c[nH]c23)cs1 |
| InChI | InChI=1S/C14H12N4O2S2/c1-2-12-17-13(8-21-12)22(19,20)18-11-5-3-4-10-9(6-15)7-16-14(10)11/h3-5,7-8,16,18H,2H2,1H3 |
| InChIKey | LJEFRHOAIYXJAH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |