C22H19F3N5O+ — CID 170958790
(3S)-1-[(4S)-4-[[2-(trifluoromethyl)indazol-4-yl]amino]-4H-chromen-3-ylidene]pyrrolidin-1-ium-3-carbonitrile (PubChem CID 170958790) has the molecular formula C22H19F3N5O+ and a molecular weight of 426.42 g/mol. Its IUPAC name is (3S)-1-[(4S)-4-[[2-(trifluoromethyl)indazol-4-yl]amino]-4H-chromen-3-ylidene]pyrrolidin-1-ium-3-carbonitrile.
| Compound Name | (3S)-1-[(4S)-4-[[2-(trifluoromethyl)indazol-4-yl]amino]-4H-chromen-3-ylidene]pyrrolidin-1-ium-3-carbonitrile |
|---|---|
| PubChem CID | 170958790 |
| Molecular Formula | C22H19F3N5O+ |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | (3S)-1-[(4S)-4-[[2-(trifluoromethyl)indazol-4-yl]amino]-4H-chromen-3-ylidene]pyrrolidin-1-ium-3-carbonitrile |
| SMILES | N#C[C@H]1CC/[N+](=C2/COc3ccccc3[C@@H]2Nc2cccc3nn(C(F)(F)F)cc23)C1 |
| InChI | InChI=1S/C22H19F3N5O/c23-22(24,25)30-12-16-17(5-3-6-18(16)28-30)27-21-15-4-1-2-7-20(15)31-13-19(21)29-9-8-14(10-26)11-29/h1-7,12,14,21,27H,8-9,11,13H2/q+1/b29-19+/t14-,21+/m1/s1 |
| InChIKey | IGVKBMQGHFYABS-YKSZSSCLSA-N |
| XLogP | 4.06 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|