C24H26FN4O2+ — CID 170958863
2-cyclopropyl-N-[(4S)-7-fluoro-3-[(2R)-2-methylmorpholin-4-ium-4-ylidene]-4H-chromen-4-yl]indazol-4-amine (PubChem CID 170958863) has the molecular formula C24H26FN4O2+ and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-cyclopropyl-N-[(4S)-7-fluoro-3-[(2R)-2-methylmorpholin-4-ium-4-ylidene]-4H-chromen-4-yl]indazol-4-amine.
| Compound Name | 2-cyclopropyl-N-[(4S)-7-fluoro-3-[(2R)-2-methylmorpholin-4-ium-4-ylidene]-4H-chromen-4-yl]indazol-4-amine |
|---|---|
| PubChem CID | 170958863 |
| Molecular Formula | C24H26FN4O2+ |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 2-cyclopropyl-N-[(4S)-7-fluoro-3-[(2R)-2-methylmorpholin-4-ium-4-ylidene]-4H-chromen-4-yl]indazol-4-amine |
| SMILES | C[C@@H]1C/[N+](=C2\COc3cc(F)ccc3[C@@H]2Nc2cccc3nn(C4CC4)cc23)CCO1 |
| InChI | InChI=1S/C24H26FN4O2/c1-15-12-28(9-10-30-15)22-14-31-23-11-16(25)5-8-18(23)24(22)26-20-3-2-4-21-19(20)13-29(27-21)17-6-7-17/h2-5,8,11,13,15,17,24,26H,6-7,9-10,12,14H2,1H3/q+1/b28-22+/t15-,24+/m1/s1 |
| InChIKey | KDZYYQQDDPXGMX-QTLNHKHISA-N |
| XLogP | 3.93 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|