C32H41N7O9S — CID 170959748
tert-butyl 7-[[4-[cyanomethyl-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyl]sulfamoyl]benzoyl]amino]heptanoate (PubChem CID 170959748) has the molecular formula C32H41N7O9S and a molecular weight of 699.79 g/mol. Its IUPAC name is tert-butyl 7-[[4-[cyanomethyl-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyl]sulfamoyl]benzoyl]amino]heptanoate.
| Compound Name | tert-butyl 7-[[4-[cyanomethyl-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyl]sulfamoyl]benzoyl]amino]heptanoate |
|---|---|
| PubChem CID | 170959748 |
| Molecular Formula | C32H41N7O9S |
| Molecular Weight | 699.79 g/mol |
| Exact Mass | 699.27 |
| IUPAC Name | tert-butyl 7-[[4-[cyanomethyl-[6-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanoyl]sulfamoyl]benzoyl]amino]heptanoate |
| SMILES | CC(C)(C)OC(=O)CCCCCCNC(=O)c1ccc(S(=O)(=O)N(CC#N)C(=O)CCCCCNc2ccc([N+](=O)[O-])c3nonc23)cc1 |
| InChI | InChI=1S/C32H41N7O9S/c1-32(2,3)47-28(41)12-8-4-5-9-21-35-31(42)23-13-15-24(16-14-23)49(45,46)38(22-19-33)27(40)11-7-6-10-20-34-25-17-18-26(39(43)44)30-29(25)36-48-37-30/h13-18,34H,4-12,20-22H2,1-3H3,(H,35,42) |
| InChIKey | MENODHJZECQWAE-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 227.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.79 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|