C30H32N6O9S — CID 177261495
2-[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)furan-3-yl]propan-2-yl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butanoate (PubChem CID 177261495) has the molecular formula C30H32N6O9S and a molecular weight of 652.69 g/mol. Its IUPAC name is 2-[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)furan-3-yl]propan-2-yl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butanoate.
| Compound Name | 2-[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)furan-3-yl]propan-2-yl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butanoate |
|---|---|
| PubChem CID | 177261495 |
| Molecular Formula | C30H32N6O9S |
| Molecular Weight | 652.69 g/mol |
| Exact Mass | 652.20 |
| IUPAC Name | 2-[5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylsulfamoyl)furan-3-yl]propan-2-yl 4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]butanoate |
| SMILES | CC(C)(OC(=O)CCCNc1ccc([N+](=O)[O-])c2nonc12)c1coc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)c1 |
| InChI | InChI=1S/C30H32N6O9S/c1-30(2,44-24(37)10-5-13-31-22-11-12-23(36(39)40)28-27(22)33-45-34-28)19-15-25(43-16-19)46(41,42)35-29(38)32-26-20-8-3-6-17(20)14-18-7-4-9-21(18)26/h11-12,14-16,31H,3-10,13H2,1-2H3,(H2,32,35,38) |
| InChIKey | IVHHTIHLGMNMGL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 208.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.69 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|