C29H28N4O6S — CID 161180071
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]phenyl]sulfonylpropan-2-one (PubChem CID 161180071) has the molecular formula C29H28N4O6S and a molecular weight of 560.63 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]phenyl]sulfonylpropan-2-one.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]phenyl]sulfonylpropan-2-one |
|---|---|
| PubChem CID | 161180071 |
| Molecular Formula | C29H28N4O6S |
| Molecular Weight | 560.63 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[4-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]phenyl]sulfonylpropan-2-one |
| SMILES | O=C(Cc1c2c(cc3c1CCC3)CCC2)CS(=O)(=O)c1ccc(CCNc2ccc([N+](=O)[O-])c3nonc23)cc1 |
| InChI | InChI=1S/C29H28N4O6S/c34-21(16-25-23-5-1-3-19(23)15-20-4-2-6-24(20)25)17-40(37,38)22-9-7-18(8-10-22)13-14-30-26-11-12-27(33(35)36)29-28(26)31-39-32-29/h7-12,15,30H,1-6,13-14,16-17H2 |
| InChIKey | KMKARDJNZGWFPS-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.63 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|