About 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one
3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one (PubChem CID 175857835) has the molecular formula C17H12N4O5
and a molecular weight of 352.31 g/mol. Its IUPAC name is 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one.
Molecular Properties
| Compound Name | 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one |
| PubChem CID | 175857835 |
| Molecular Formula | C17H12N4O5 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1CCNc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C17H12N4O5/c22-17-11(9-10-3-1-2-4-14(10)25-17)7-8-18-12-5-6-13(21(23)24)16-15(12)19-26-20-16/h1-6,9,18H,7-8H2 |
| InChIKey | BVWIZGMFCGXLGF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 124.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one?
The IUPAC name of 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one (CID 175857835) is 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one.
What is the SMILES notation for 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one?
The canonical SMILES for 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one is O=c1oc2ccccc2cc1CCNc1ccc([N+](=O)[O-])c2nonc12.
What is the InChIKey of 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one?
The InChIKey is BVWIZGMFCGXLGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N4O5/c22-17-11(9-10-3-1-2-4-14(10)25-17)7-8-18-12-5-6-13(21(23)24)16-15(12)19-26-20-16/h1-6,9,18H,7-8H2.
What are the key properties of 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one?
3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one has a molecular weight of 352.31 g/mol, XLogP of 2.89, 5 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]ethyl]chromen-2-one is sourced from PubChem (CID 175857835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).