C14H26N2O2 — CID 170964425
(2E)-N-(3-hydroxy-2,2-dimethylpropyl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;methanamine (PubChem CID 170964425) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2E)-N-(3-hydroxy-2,2-dimethylpropyl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;methanamine.
| Compound Name | (2E)-N-(3-hydroxy-2,2-dimethylpropyl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;methanamine |
|---|---|
| PubChem CID | 170964425 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (2E)-N-(3-hydroxy-2,2-dimethylpropyl)-2-[(Z)-prop-1-enyl]penta-2,4-dienamide;methanamine |
| SMILES | C=C/C=C(\C=C/C)C(=O)NCC(C)(C)CO.CN |
| InChI | InChI=1S/C13H21NO2.CH5N/c1-5-7-11(8-6-2)12(16)14-9-13(3,4)10-15;1-2/h5-8,15H,1,9-10H2,2-4H3,(H,14,16);2H2,1H3/b8-6-,11-7+; |
| InChIKey | IODWSHCVTUNJSN-YMMIPXNQSA-N |
| XLogP | 1.38 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|