C9H12FNO2 — CID 145399724
2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide (PubChem CID 145399724) has the molecular formula C9H12FNO2 and a molecular weight of 185.20 g/mol. Its IUPAC name is 2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide.
| Compound Name | 2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 145399724 |
| Molecular Formula | C9H12FNO2 |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 2-fluoro-N-(3-hydroxypropyl)cyclopenta-1,4-diene-1-carboxamide |
| SMILES | O=C(NCCCO)C1=C(F)CC=C1 |
| InChI | InChI=1S/C9H12FNO2/c10-8-4-1-3-7(8)9(13)11-5-2-6-12/h1,3,12H,2,4-6H2,(H,11,13) |
| InChIKey | OWYXVWFQECSQGQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|