C25H42O3 — CID 170968615
4-(6-methyl-3-prop-1-en-2-ylhept-6-enoxy)-4-(5-methyl-2-prop-1-en-2-ylhex-5-enoxy)butanal (PubChem CID 170968615) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is 4-(6-methyl-3-prop-1-en-2-ylhept-6-enoxy)-4-(5-methyl-2-prop-1-en-2-ylhex-5-enoxy)butanal.
| Compound Name | 4-(6-methyl-3-prop-1-en-2-ylhept-6-enoxy)-4-(5-methyl-2-prop-1-en-2-ylhex-5-enoxy)butanal |
|---|---|
| PubChem CID | 170968615 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 4-(6-methyl-3-prop-1-en-2-ylhept-6-enoxy)-4-(5-methyl-2-prop-1-en-2-ylhex-5-enoxy)butanal |
| SMILES | C=C(C)CCC(CCOC(CCC=O)OCC(CCC(=C)C)C(=C)C)C(=C)C |
| InChI | InChI=1S/C25H42O3/c1-19(2)11-13-23(21(5)6)15-17-27-25(10-9-16-26)28-18-24(22(7)8)14-12-20(3)4/h16,23-25H,1,3,5,7,9-15,17-18H2,2,4,6,8H3 |
| InChIKey | METXITCRHKEXBR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|