C22H23N7OS — CID 170968691
N-[1-[4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-pyridinyl]pyrazol-4-yl]sulfanyl-6-methoxy-1-methylindazol-7-amine (PubChem CID 170968691) has the molecular formula C22H23N7OS and a molecular weight of 433.54 g/mol. Its IUPAC name is N-[1-[4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-pyridinyl]pyrazol-4-yl]sulfanyl-6-methoxy-1-methylindazol-7-amine.
| Compound Name | N-[1-[4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-pyridinyl]pyrazol-4-yl]sulfanyl-6-methoxy-1-methylindazol-7-amine |
|---|---|
| PubChem CID | 170968691 |
| Molecular Formula | C22H23N7OS |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | N-[1-[4-(2-azabicyclo[2.1.1]hexan-2-yl)-2-pyridinyl]pyrazol-4-yl]sulfanyl-6-methoxy-1-methylindazol-7-amine |
| SMILES | COc1ccc2cnn(C)c2c1NSc1cnn(-c2cc(N3CC4CC3C4)ccn2)c1 |
| InChI | InChI=1S/C22H23N7OS/c1-27-22-15(10-24-27)3-4-19(30-2)21(22)26-31-18-11-25-29(13-18)20-9-16(5-6-23-20)28-12-14-7-17(28)8-14/h3-6,9-11,13-14,17,26H,7-8,12H2,1-2H3 |
| InChIKey | FCJXMOXYGLFPDR-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|