C22H24N6O2S — CID 170968757
1-[2-[4-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanylpyrazol-1-yl]-4-pyridinyl]-3-methylcyclobutan-1-ol (PubChem CID 170968757) has the molecular formula C22H24N6O2S and a molecular weight of 436.54 g/mol. Its IUPAC name is 1-[2-[4-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanylpyrazol-1-yl]-4-pyridinyl]-3-methylcyclobutan-1-ol.
| Compound Name | 1-[2-[4-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanylpyrazol-1-yl]-4-pyridinyl]-3-methylcyclobutan-1-ol |
|---|---|
| PubChem CID | 170968757 |
| Molecular Formula | C22H24N6O2S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.17 |
| IUPAC Name | 1-[2-[4-[(6-methoxy-1-methylindazol-7-yl)amino]sulfanylpyrazol-1-yl]-4-pyridinyl]-3-methylcyclobutan-1-ol |
| SMILES | COc1ccc2cnn(C)c2c1NSc1cnn(-c2cc(C3(O)CC(C)C3)ccn2)c1 |
| InChI | InChI=1S/C22H24N6O2S/c1-14-9-22(29,10-14)16-6-7-23-19(8-16)28-13-17(12-25-28)31-26-20-18(30-3)5-4-15-11-24-27(2)21(15)20/h4-8,11-14,26,29H,9-10H2,1-3H3 |
| InChIKey | WNOYHLJEOOXIGE-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|