C21H22N6S — CID 170969433
N-[1-(4-cyclopropyl-2-pyridinyl)pyrazol-4-yl]sulfanyl-6-ethyl-1-methylindazol-7-amine (PubChem CID 170969433) has the molecular formula C21H22N6S and a molecular weight of 390.52 g/mol. Its IUPAC name is N-[1-(4-cyclopropyl-2-pyridinyl)pyrazol-4-yl]sulfanyl-6-ethyl-1-methylindazol-7-amine.
| Compound Name | N-[1-(4-cyclopropyl-2-pyridinyl)pyrazol-4-yl]sulfanyl-6-ethyl-1-methylindazol-7-amine |
|---|---|
| PubChem CID | 170969433 |
| Molecular Formula | C21H22N6S |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[1-(4-cyclopropyl-2-pyridinyl)pyrazol-4-yl]sulfanyl-6-ethyl-1-methylindazol-7-amine |
| SMILES | CCc1ccc2cnn(C)c2c1NSc1cnn(-c2cc(C3CC3)ccn2)c1 |
| InChI | InChI=1S/C21H22N6S/c1-3-14-4-7-17-11-23-26(2)21(17)20(14)25-28-18-12-24-27(13-18)19-10-16(8-9-22-19)15-5-6-15/h4,7-13,15,25H,3,5-6H2,1-2H3 |
| InChIKey | POXSYBAIRKQTJI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 60.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|