C9H11N3O2 — CID 170969058
2,5-dimethyl-6-nitro-1,3-dihydroindazole (PubChem CID 170969058) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 2,5-dimethyl-6-nitro-1,3-dihydroindazole.
| Compound Name | 2,5-dimethyl-6-nitro-1,3-dihydroindazole |
|---|---|
| PubChem CID | 170969058 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2,5-dimethyl-6-nitro-1,3-dihydroindazole |
| SMILES | Cc1cc2c(cc1[N+](=O)[O-])NN(C)C2 |
| InChI | InChI=1S/C9H11N3O2/c1-6-3-7-5-11(2)10-8(7)4-9(6)12(13)14/h3-4,10H,5H2,1-2H3 |
| InChIKey | ZHQBGXCXFXOKCT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|