C16H24N4O5S — CID 170969990
methanol;methyl 2-[2-[(2-piperidin-4-yl-1,3-thiazole-4-carbonyl)amino]prop-2-enoylamino]acetate (PubChem CID 170969990) has the molecular formula C16H24N4O5S and a molecular weight of 384.46 g/mol. Its IUPAC name is methanol;methyl 2-[2-[(2-piperidin-4-yl-1,3-thiazole-4-carbonyl)amino]prop-2-enoylamino]acetate.
| Compound Name | methanol;methyl 2-[2-[(2-piperidin-4-yl-1,3-thiazole-4-carbonyl)amino]prop-2-enoylamino]acetate |
|---|---|
| PubChem CID | 170969990 |
| Molecular Formula | C16H24N4O5S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | methanol;methyl 2-[2-[(2-piperidin-4-yl-1,3-thiazole-4-carbonyl)amino]prop-2-enoylamino]acetate |
| SMILES | C=C(NC(=O)c1csc(C2CCNCC2)n1)C(=O)NCC(=O)OC.CO |
| InChI | InChI=1S/C15H20N4O4S.CH4O/c1-9(13(21)17-7-12(20)23-2)18-14(22)11-8-24-15(19-11)10-3-5-16-6-4-10;1-2/h8,10,16H,1,3-7H2,2H3,(H,17,21)(H,18,22);2H,1H3 |
| InChIKey | INNHXRDHEFUNFZ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|