C26H35N3O6S — CID 170970176
tert-butyl acetate;methyl 2-[2-[[2-[(2Z,4E)-7-methylocta-2,4,6-trien-4-yl]-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate (PubChem CID 170970176) has the molecular formula C26H35N3O6S and a molecular weight of 517.65 g/mol. Its IUPAC name is tert-butyl acetate;methyl 2-[2-[[2-[(2Z,4E)-7-methylocta-2,4,6-trien-4-yl]-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate.
| Compound Name | tert-butyl acetate;methyl 2-[2-[[2-[(2Z,4E)-7-methylocta-2,4,6-trien-4-yl]-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate |
|---|---|
| PubChem CID | 170970176 |
| Molecular Formula | C26H35N3O6S |
| Molecular Weight | 517.65 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | tert-butyl acetate;methyl 2-[2-[[2-[(2Z,4E)-7-methylocta-2,4,6-trien-4-yl]-1,3-thiazole-4-carbonyl]amino]prop-2-enoylamino]prop-2-enoate |
| SMILES | C=C(NC(=O)c1csc(C(/C=C\C)=C/C=C(C)C)n1)C(=O)NC(=C)C(=O)OC.CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H23N3O4S.C6H12O2/c1-7-8-15(10-9-12(2)3)19-23-16(11-28-19)18(25)21-13(4)17(24)22-14(5)20(26)27-6;1-5(7)8-6(2,3)4/h7-11H,4-5H2,1-3,6H3,(H,21,25)(H,22,24);1-4H3/b8-7-,15-10+; |
| InChIKey | UDRASLLYHHLZIQ-UKXBUECMSA-N |
| XLogP | 4.46 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|