C20H29NO4S — CID 170970179
tert-butyl acetate;2-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-1,3-thiazole-4-carboxylic acid (PubChem CID 170970179) has the molecular formula C20H29NO4S and a molecular weight of 379.52 g/mol. Its IUPAC name is tert-butyl acetate;2-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-1,3-thiazole-4-carboxylic acid.
| Compound Name | tert-butyl acetate;2-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 170970179 |
| Molecular Formula | C20H29NO4S |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | tert-butyl acetate;2-[(2Z,4E,6E)-7-methylnona-2,4,6-trien-4-yl]-1,3-thiazole-4-carboxylic acid |
| SMILES | C/C=C\C(=C/C=C(\C)CC)c1nc(C(=O)O)cs1.CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H17NO2S.C6H12O2/c1-4-6-11(8-7-10(3)5-2)13-15-12(9-18-13)14(16)17;1-5(7)8-6(2,3)4/h4,6-9H,5H2,1-3H3,(H,16,17);1-4H3/b6-4-,10-7+,11-8+; |
| InChIKey | KPQBTABFIWEMRB-LFCJICSYSA-N |
| XLogP | 5.51 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|