C28H43N5O3 — CID 170970436
(6aR,9R)-4-[(Z)-2-amino-3-(ethylperoxyamino)prop-2-enyl]-N,N-diethyl-6a,7-dimethyl-8,9-dihydro-6H-indolo[4,3-fg]quinoline-9-carboxamide;ethane (PubChem CID 170970436) has the molecular formula C28H43N5O3 and a molecular weight of 497.68 g/mol. Its IUPAC name is (6aR,9R)-4-[(Z)-2-amino-3-(ethylperoxyamino)prop-2-enyl]-N,N-diethyl-6a,7-dimethyl-8,9-dihydro-6H-indolo[4,3-fg]quinoline-9-carboxamide;ethane.
| Compound Name | (6aR,9R)-4-[(Z)-2-amino-3-(ethylperoxyamino)prop-2-enyl]-N,N-diethyl-6a,7-dimethyl-8,9-dihydro-6H-indolo[4,3-fg]quinoline-9-carboxamide;ethane |
|---|---|
| PubChem CID | 170970436 |
| Molecular Formula | C28H43N5O3 |
| Molecular Weight | 497.68 g/mol |
| Exact Mass | 497.34 |
| IUPAC Name | (6aR,9R)-4-[(Z)-2-amino-3-(ethylperoxyamino)prop-2-enyl]-N,N-diethyl-6a,7-dimethyl-8,9-dihydro-6H-indolo[4,3-fg]quinoline-9-carboxamide;ethane |
| SMILES | CC.CCOON/C=C(\N)Cn1cc2c3c(cccc31)C1=C[C@@H](C(=O)N(CC)CC)CN(C)[C@]1(C)C2 |
| InChI | InChI=1S/C26H37N5O3.C2H6/c1-6-30(7-2)25(32)18-12-22-21-10-9-11-23-24(21)19(13-26(22,4)29(5)15-18)16-31(23)17-20(27)14-28-34-33-8-3;1-2/h9-12,14,16,18,28H,6-8,13,15,17,27H2,1-5H3;1-2H3/b20-14-;/t18-,26-;/m1./s1 |
| InChIKey | XJLGOSZVNVDIHH-RPGGDAKISA-N |
| XLogP | 4.07 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.68 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|